C18H14N3O4S- — CID 7802760
2-[(Z)-[3-(4-methoxyphenyl)-5-oxo-2-sulfanylideneimidazolidin-1-yl]iminomethyl]benzoate (PubChem CID 7802760) has the molecular formula C18H14N3O4S- and a molecular weight of 368.39 g/mol. Its IUPAC name is 2-[(Z)-[3-(4-methoxyphenyl)-5-oxo-2-sulfanylideneimidazolidin-1-yl]iminomethyl]benzoate.
| Compound Name | 2-[(Z)-[3-(4-methoxyphenyl)-5-oxo-2-sulfanylideneimidazolidin-1-yl]iminomethyl]benzoate |
|---|---|
| PubChem CID | 7802760 |
| Molecular Formula | C18H14N3O4S- |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.07 |
| IUPAC Name | 2-[(Z)-[3-(4-methoxyphenyl)-5-oxo-2-sulfanylideneimidazolidin-1-yl]iminomethyl]benzoate |
| SMILES | COc1ccc(N2CC(=O)N(/N=C\c3ccccc3C(=O)[O-])C2=S)cc1 |
| InChI | InChI=1S/C18H15N3O4S/c1-25-14-8-6-13(7-9-14)20-11-16(22)21(18(20)26)19-10-12-4-2-3-5-15(12)17(23)24/h2-10H,11H2,1H3,(H,23,24)/p-1/b19-10- |
| InChIKey | VFMPJEPMQOPHDZ-GRSHGNNSSA-M |
| XLogP | 1.03 |
| TPSA | 85.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|