C12H12ClF2NO2 — CID 171187087
(4R)-4-(4-chloro-2,6-difluorophenyl)-5,5-dimethyl-1,3-oxazinan-2-one (PubChem CID 171187087) has the molecular formula C12H12ClF2NO2 and a molecular weight of 275.68 g/mol. Its IUPAC name is (4R)-4-(4-chloro-2,6-difluorophenyl)-5,5-dimethyl-1,3-oxazinan-2-one.
| Compound Name | (4R)-4-(4-chloro-2,6-difluorophenyl)-5,5-dimethyl-1,3-oxazinan-2-one |
|---|---|
| PubChem CID | 171187087 |
| Molecular Formula | C12H12ClF2NO2 |
| Molecular Weight | 275.68 g/mol |
| Exact Mass | 275.05 |
| IUPAC Name | (4R)-4-(4-chloro-2,6-difluorophenyl)-5,5-dimethyl-1,3-oxazinan-2-one |
| SMILES | CC1(C)COC(=O)N[C@H]1c1c(F)cc(Cl)cc1F |
| InChI | InChI=1S/C12H12ClF2NO2/c1-12(2)5-18-11(17)16-10(12)9-7(14)3-6(13)4-8(9)15/h3-4,10H,5H2,1-2H3,(H,16,17)/t10-/m0/s1 |
| InChIKey | PXDFWSLQLKRWNN-JTQLQIEISA-N |
| XLogP | 3.43 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.68 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |