C12H14Cl3NO3 — CID 171188572
(4S)-4-(2,4-dichloro-6-hydroxyphenyl)-5,5-dimethyl-1,3-oxazinan-2-one;hydrochloride (PubChem CID 171188572) has the molecular formula C12H14Cl3NO3 and a molecular weight of 326.61 g/mol. Its IUPAC name is (4S)-4-(2,4-dichloro-6-hydroxyphenyl)-5,5-dimethyl-1,3-oxazinan-2-one;hydrochloride.
| Compound Name | (4S)-4-(2,4-dichloro-6-hydroxyphenyl)-5,5-dimethyl-1,3-oxazinan-2-one;hydrochloride |
|---|---|
| PubChem CID | 171188572 |
| Molecular Formula | C12H14Cl3NO3 |
| Molecular Weight | 326.61 g/mol |
| Exact Mass | 325.00 |
| IUPAC Name | (4S)-4-(2,4-dichloro-6-hydroxyphenyl)-5,5-dimethyl-1,3-oxazinan-2-one;hydrochloride |
| SMILES | CC1(C)COC(=O)N[C@@H]1c1c(O)cc(Cl)cc1Cl.Cl |
| InChI | InChI=1S/C12H13Cl2NO3.ClH/c1-12(2)5-18-11(17)15-10(12)9-7(14)3-6(13)4-8(9)16;/h3-4,10,16H,5H2,1-2H3,(H,15,17);1H/t10-;/m1./s1 |
| InChIKey | AASZPANCPHFWET-HNCPQSOCSA-N |
| XLogP | 3.93 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.61 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|