C13H16ClNO3 — CID 171187385
(4R)-4-(5-chloro-2-hydroxy-3-methylphenyl)-5,5-dimethyl-1,3-oxazinan-2-one (PubChem CID 171187385) has the molecular formula C13H16ClNO3 and a molecular weight of 269.73 g/mol. Its IUPAC name is (4R)-4-(5-chloro-2-hydroxy-3-methylphenyl)-5,5-dimethyl-1,3-oxazinan-2-one.
| Compound Name | (4R)-4-(5-chloro-2-hydroxy-3-methylphenyl)-5,5-dimethyl-1,3-oxazinan-2-one |
|---|---|
| PubChem CID | 171187385 |
| Molecular Formula | C13H16ClNO3 |
| Molecular Weight | 269.73 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | (4R)-4-(5-chloro-2-hydroxy-3-methylphenyl)-5,5-dimethyl-1,3-oxazinan-2-one |
| SMILES | Cc1cc(Cl)cc([C@@H]2NC(=O)OCC2(C)C)c1O |
| InChI | InChI=1S/C13H16ClNO3/c1-7-4-8(14)5-9(10(7)16)11-13(2,3)6-18-12(17)15-11/h4-5,11,16H,6H2,1-3H3,(H,15,17)/t11-/m0/s1 |
| InChIKey | IBKCMQBSIRDIBC-NSHDSACASA-N |
| XLogP | 3.16 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.73 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|