C10H9Br2ClF2N2O2 — CID 171187628
(4R)-4-(2-amino-3,5-dibromophenyl)-5,5-difluoro-1,3-oxazinan-2-one;hydrochloride (PubChem CID 171187628) has the molecular formula C10H9Br2ClF2N2O2 and a molecular weight of 422.45 g/mol. Its IUPAC name is (4R)-4-(2-amino-3,5-dibromophenyl)-5,5-difluoro-1,3-oxazinan-2-one;hydrochloride.
| Compound Name | (4R)-4-(2-amino-3,5-dibromophenyl)-5,5-difluoro-1,3-oxazinan-2-one;hydrochloride |
|---|---|
| PubChem CID | 171187628 |
| Molecular Formula | C10H9Br2ClF2N2O2 |
| Molecular Weight | 422.45 g/mol |
| Exact Mass | 419.87 |
| IUPAC Name | (4R)-4-(2-amino-3,5-dibromophenyl)-5,5-difluoro-1,3-oxazinan-2-one;hydrochloride |
| SMILES | Cl.Nc1c(Br)cc(Br)cc1[C@H]1NC(=O)OCC1(F)F |
| InChI | InChI=1S/C10H8Br2F2N2O2.ClH/c11-4-1-5(7(15)6(12)2-4)8-10(13,14)3-18-9(17)16-8;/h1-2,8H,3,15H2,(H,16,17);1H/t8-;/m1./s1 |
| InChIKey | WIEKAFQQQBOWEX-DDWIOCJRSA-N |
| XLogP | 3.63 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.45 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|