C10H6F5NO2 — CID 171188163
(4R)-5,5-difluoro-4-(3,4,5-trifluorophenyl)-1,3-oxazinan-2-one (PubChem CID 171188163) has the molecular formula C10H6F5NO2 and a molecular weight of 267.15 g/mol. Its IUPAC name is (4R)-5,5-difluoro-4-(3,4,5-trifluorophenyl)-1,3-oxazinan-2-one.
| Compound Name | (4R)-5,5-difluoro-4-(3,4,5-trifluorophenyl)-1,3-oxazinan-2-one |
|---|---|
| PubChem CID | 171188163 |
| Molecular Formula | C10H6F5NO2 |
| Molecular Weight | 267.15 g/mol |
| Exact Mass | 267.03 |
| IUPAC Name | (4R)-5,5-difluoro-4-(3,4,5-trifluorophenyl)-1,3-oxazinan-2-one |
| SMILES | O=C1N[C@H](c2cc(F)c(F)c(F)c2)C(F)(F)CO1 |
| InChI | InChI=1S/C10H6F5NO2/c11-5-1-4(2-6(12)7(5)13)8-10(14,15)3-18-9(17)16-8/h1-2,8H,3H2,(H,16,17)/t8-/m1/s1 |
| InChIKey | QDQCHCCIGHQCJT-MRVPVSSYSA-N |
| XLogP | 2.52 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.15 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|