C13H15F2NO2 — CID 171188565
(4R)-5,5-difluoro-4-(3-propan-2-ylphenyl)-1,3-oxazinan-2-one (PubChem CID 171188565) has the molecular formula C13H15F2NO2 and a molecular weight of 255.26 g/mol. Its IUPAC name is (4R)-5,5-difluoro-4-(3-propan-2-ylphenyl)-1,3-oxazinan-2-one.
| Compound Name | (4R)-5,5-difluoro-4-(3-propan-2-ylphenyl)-1,3-oxazinan-2-one |
|---|---|
| PubChem CID | 171188565 |
| Molecular Formula | C13H15F2NO2 |
| Molecular Weight | 255.26 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | (4R)-5,5-difluoro-4-(3-propan-2-ylphenyl)-1,3-oxazinan-2-one |
| SMILES | CC(C)c1cccc([C@H]2NC(=O)OCC2(F)F)c1 |
| InChI | InChI=1S/C13H15F2NO2/c1-8(2)9-4-3-5-10(6-9)11-13(14,15)7-18-12(17)16-11/h3-6,8,11H,7H2,1-2H3,(H,16,17)/t11-/m1/s1 |
| InChIKey | FOQXHWMTWAQZDR-LLVKDONJSA-N |
| XLogP | 3.23 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.26 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |