C14H22ClNO3 — CID 171199552
(1R)-3-methyl-1-(2,4,5-trimethoxyphenyl)but-3-en-1-amine;hydrochloride (PubChem CID 171199552) has the molecular formula C14H22ClNO3 and a molecular weight of 287.79 g/mol. Its IUPAC name is (1R)-3-methyl-1-(2,4,5-trimethoxyphenyl)but-3-en-1-amine;hydrochloride.
| Compound Name | (1R)-3-methyl-1-(2,4,5-trimethoxyphenyl)but-3-en-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171199552 |
| Molecular Formula | C14H22ClNO3 |
| Molecular Weight | 287.79 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | (1R)-3-methyl-1-(2,4,5-trimethoxyphenyl)but-3-en-1-amine;hydrochloride |
| SMILES | C=C(C)C[C@@H](N)c1cc(OC)c(OC)cc1OC.Cl |
| InChI | InChI=1S/C14H21NO3.ClH/c1-9(2)6-11(15)10-7-13(17-4)14(18-5)8-12(10)16-3;/h7-8,11H,1,6,15H2,2-5H3;1H/t11-;/m1./s1 |
| InChIKey | HXFYDPGHPCGJLP-RFVHGSKJSA-N |
| XLogP | 3.10 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.79 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|