C15H21ClN2O — CID 171214154
1-[3-[(1R)-1-aminopentyl]indol-1-yl]ethanone;hydrochloride (PubChem CID 171214154) has the molecular formula C15H21ClN2O and a molecular weight of 280.80 g/mol. Its IUPAC name is 1-[3-[(1R)-1-aminopentyl]indol-1-yl]ethanone;hydrochloride.
| Compound Name | 1-[3-[(1R)-1-aminopentyl]indol-1-yl]ethanone;hydrochloride |
|---|---|
| PubChem CID | 171214154 |
| Molecular Formula | C15H21ClN2O |
| Molecular Weight | 280.80 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | 1-[3-[(1R)-1-aminopentyl]indol-1-yl]ethanone;hydrochloride |
| SMILES | CCCC[C@@H](N)c1cn(C(C)=O)c2ccccc12.Cl |
| InChI | InChI=1S/C15H20N2O.ClH/c1-3-4-8-14(16)13-10-17(11(2)18)15-9-6-5-7-12(13)15;/h5-7,9-10,14H,3-4,8,16H2,1-2H3;1H/t14-;/m1./s1 |
| InChIKey | ORLWZUBFVDSVQC-PFEQFJNWSA-N |
| XLogP | 3.91 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.80 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |