C16H22Cl2FN3O — CID 171282825
1-[3-[(1R)-2-fluoro-1-piperazin-1-ylethyl]indol-1-yl]ethanone;dihydrochloride (PubChem CID 171282825) has the molecular formula C16H22Cl2FN3O and a molecular weight of 362.28 g/mol. Its IUPAC name is 1-[3-[(1R)-2-fluoro-1-piperazin-1-ylethyl]indol-1-yl]ethanone;dihydrochloride.
| Compound Name | 1-[3-[(1R)-2-fluoro-1-piperazin-1-ylethyl]indol-1-yl]ethanone;dihydrochloride |
|---|---|
| PubChem CID | 171282825 |
| Molecular Formula | C16H22Cl2FN3O |
| Molecular Weight | 362.28 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | 1-[3-[(1R)-2-fluoro-1-piperazin-1-ylethyl]indol-1-yl]ethanone;dihydrochloride |
| SMILES | CC(=O)n1cc([C@H](CF)N2CCNCC2)c2ccccc21.Cl.Cl |
| InChI | InChI=1S/C16H20FN3O.2ClH/c1-12(21)20-11-14(13-4-2-3-5-15(13)20)16(10-17)19-8-6-18-7-9-19;;/h2-5,11,16,18H,6-10H2,1H3;2*1H/t16-;;/m0../s1 |
| InChIKey | TWWAVNRHADCAGC-SQKCAUCHSA-N |
| XLogP | 3.06 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.28 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |