C20H31Cl2N3O — CID 171310478
1-[3-[(1S)-4-methyl-1-piperazin-1-ylpentyl]indol-1-yl]ethanone;dihydrochloride (PubChem CID 171310478) has the molecular formula C20H31Cl2N3O and a molecular weight of 400.39 g/mol. Its IUPAC name is 1-[3-[(1S)-4-methyl-1-piperazin-1-ylpentyl]indol-1-yl]ethanone;dihydrochloride.
| Compound Name | 1-[3-[(1S)-4-methyl-1-piperazin-1-ylpentyl]indol-1-yl]ethanone;dihydrochloride |
|---|---|
| PubChem CID | 171310478 |
| Molecular Formula | C20H31Cl2N3O |
| Molecular Weight | 400.39 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | 1-[3-[(1S)-4-methyl-1-piperazin-1-ylpentyl]indol-1-yl]ethanone;dihydrochloride |
| SMILES | CC(=O)n1cc([C@H](CCC(C)C)N2CCNCC2)c2ccccc21.Cl.Cl |
| InChI | InChI=1S/C20H29N3O.2ClH/c1-15(2)8-9-19(22-12-10-21-11-13-22)18-14-23(16(3)24)20-7-5-4-6-17(18)20;;/h4-7,14-15,19,21H,8-13H2,1-3H3;2*1H/t19-;;/m0../s1 |
| InChIKey | LZSJHDDKHCLQSL-TXEPZDRESA-N |
| XLogP | 4.53 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.39 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |