C11H15BrClNO2 — CID 171218390
(1S)-1-(2-bromo-4,5-dimethoxyphenyl)prop-2-en-1-amine;hydrochloride (PubChem CID 171218390) has the molecular formula C11H15BrClNO2 and a molecular weight of 308.60 g/mol. Its IUPAC name is (1S)-1-(2-bromo-4,5-dimethoxyphenyl)prop-2-en-1-amine;hydrochloride.
| Compound Name | (1S)-1-(2-bromo-4,5-dimethoxyphenyl)prop-2-en-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171218390 |
| Molecular Formula | C11H15BrClNO2 |
| Molecular Weight | 308.60 g/mol |
| Exact Mass | 307.00 |
| IUPAC Name | (1S)-1-(2-bromo-4,5-dimethoxyphenyl)prop-2-en-1-amine;hydrochloride |
| SMILES | C=C[C@H](N)c1cc(OC)c(OC)cc1Br.Cl |
| InChI | InChI=1S/C11H14BrNO2.ClH/c1-4-9(13)7-5-10(14-2)11(15-3)6-8(7)12;/h4-6,9H,1,13H2,2-3H3;1H/t9-;/m0./s1 |
| InChIKey | SANFKKZZOVEFLI-FVGYRXGTSA-N |
| XLogP | 3.07 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.60 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|