C13H17BrO3 — CID 71541636
2-(2-bromo-4,5-dimethoxyphenyl)pent-4-en-1-ol (PubChem CID 71541636) has the molecular formula C13H17BrO3 and a molecular weight of 301.18 g/mol. Its IUPAC name is 2-(2-bromo-4,5-dimethoxyphenyl)pent-4-en-1-ol.
| Compound Name | 2-(2-bromo-4,5-dimethoxyphenyl)pent-4-en-1-ol |
|---|---|
| PubChem CID | 71541636 |
| Molecular Formula | C13H17BrO3 |
| Molecular Weight | 301.18 g/mol |
| Exact Mass | 300.04 |
| IUPAC Name | 2-(2-bromo-4,5-dimethoxyphenyl)pent-4-en-1-ol |
| SMILES | C=CCC(CO)c1cc(OC)c(OC)cc1Br |
| InChI | InChI=1S/C13H17BrO3/c1-4-5-9(8-15)10-6-12(16-2)13(17-3)7-11(10)14/h4,6-7,9,15H,1,5,8H2,2-3H3 |
| InChIKey | AGOYAQSDQUTKPH-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.18 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|