C13H20N2O3 — CID 105289545
1-(2,4,5-trimethoxyphenyl)but-3-enylhydrazine (PubChem CID 105289545) has the molecular formula C13H20N2O3 and a molecular weight of 252.31 g/mol. Its IUPAC name is 1-(2,4,5-trimethoxyphenyl)but-3-enylhydrazine.
| Compound Name | 1-(2,4,5-trimethoxyphenyl)but-3-enylhydrazine |
|---|---|
| PubChem CID | 105289545 |
| Molecular Formula | C13H20N2O3 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | 1-(2,4,5-trimethoxyphenyl)but-3-enylhydrazine |
| SMILES | C=CCC(NN)c1cc(OC)c(OC)cc1OC |
| InChI | InChI=1S/C13H20N2O3/c1-5-6-10(15-14)9-7-12(17-3)13(18-4)8-11(9)16-2/h5,7-8,10,15H,1,6,14H2,2-4H3 |
| InChIKey | UICIYDCBXKQYKZ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 65.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|