C13H20N2O4 — CID 171236013
2-[(1S)-1-amino-4-methylpentyl]-6-methoxy-4-nitrophenol (PubChem CID 171236013) has the molecular formula C13H20N2O4 and a molecular weight of 268.31 g/mol. Its IUPAC name is 2-[(1S)-1-amino-4-methylpentyl]-6-methoxy-4-nitrophenol.
| Compound Name | 2-[(1S)-1-amino-4-methylpentyl]-6-methoxy-4-nitrophenol |
|---|---|
| PubChem CID | 171236013 |
| Molecular Formula | C13H20N2O4 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | 2-[(1S)-1-amino-4-methylpentyl]-6-methoxy-4-nitrophenol |
| SMILES | COc1cc([N+](=O)[O-])cc([C@@H](N)CCC(C)C)c1O |
| InChI | InChI=1S/C13H20N2O4/c1-8(2)4-5-11(14)10-6-9(15(17)18)7-12(19-3)13(10)16/h6-8,11,16H,4-5,14H2,1-3H3/t11-/m0/s1 |
| InChIKey | FDXRJVJBERHUPB-NSHDSACASA-N |
| XLogP | 2.74 |
| TPSA | 98.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|