C11H12F3N3O5 — CID 171238210
methyl (2R)-2-amino-3-[2-amino-3-nitro-5-(trifluoromethoxy)phenyl]propanoate (PubChem CID 171238210) has the molecular formula C11H12F3N3O5 and a molecular weight of 323.23 g/mol. Its IUPAC name is methyl (2R)-2-amino-3-[2-amino-3-nitro-5-(trifluoromethoxy)phenyl]propanoate.
| Compound Name | methyl (2R)-2-amino-3-[2-amino-3-nitro-5-(trifluoromethoxy)phenyl]propanoate |
|---|---|
| PubChem CID | 171238210 |
| Molecular Formula | C11H12F3N3O5 |
| Molecular Weight | 323.23 g/mol |
| Exact Mass | 323.07 |
| IUPAC Name | methyl (2R)-2-amino-3-[2-amino-3-nitro-5-(trifluoromethoxy)phenyl]propanoate |
| SMILES | COC(=O)[C@H](N)Cc1cc(OC(F)(F)F)cc([N+](=O)[O-])c1N |
| InChI | InChI=1S/C11H12F3N3O5/c1-21-10(18)7(15)3-5-2-6(22-11(12,13)14)4-8(9(5)16)17(19)20/h2,4,7H,3,15-16H2,1H3/t7-/m1/s1 |
| InChIKey | KIEBWAJGBBGUCV-SSDOTTSWSA-N |
| XLogP | 1.12 |
| TPSA | 130.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.23 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|