C12H15Cl3FNO2 — CID 171244851
methyl (3S)-3-amino-3-(3,6-dichloro-2-fluorophenyl)-2,2-dimethylpropanoate;hydrochloride (PubChem CID 171244851) has the molecular formula C12H15Cl3FNO2 and a molecular weight of 330.61 g/mol. Its IUPAC name is methyl (3S)-3-amino-3-(3,6-dichloro-2-fluorophenyl)-2,2-dimethylpropanoate;hydrochloride.
| Compound Name | methyl (3S)-3-amino-3-(3,6-dichloro-2-fluorophenyl)-2,2-dimethylpropanoate;hydrochloride |
|---|---|
| PubChem CID | 171244851 |
| Molecular Formula | C12H15Cl3FNO2 |
| Molecular Weight | 330.61 g/mol |
| Exact Mass | 329.02 |
| IUPAC Name | methyl (3S)-3-amino-3-(3,6-dichloro-2-fluorophenyl)-2,2-dimethylpropanoate;hydrochloride |
| SMILES | COC(=O)C(C)(C)[C@H](N)c1c(Cl)ccc(Cl)c1F.Cl |
| InChI | InChI=1S/C12H14Cl2FNO2.ClH/c1-12(2,11(17)18-3)10(16)8-6(13)4-5-7(14)9(8)15;/h4-5,10H,16H2,1-3H3;1H/t10-;/m1./s1 |
| InChIKey | AOVSMZHOYYVDLV-HNCPQSOCSA-N |
| XLogP | 3.75 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.61 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|