About (4R)-4-amino-6-fluoro-3,4-dihydro-2H-chromene-8-carboxylic acid;hydrochloride
(4R)-4-amino-6-fluoro-3,4-dihydro-2H-chromene-8-carboxylic acid;hydrochloride (PubChem CID 171252439) has the molecular formula C10H11ClFNO3
and a molecular weight of 247.65 g/mol. Its IUPAC name is (4R)-4-amino-6-fluoro-3,4-dihydro-2H-chromene-8-carboxylic acid;hydrochloride.
Molecular Properties
| Compound Name | (4R)-4-amino-6-fluoro-3,4-dihydro-2H-chromene-8-carboxylic acid;hydrochloride |
| PubChem CID | 171252439 |
| Molecular Formula | C10H11ClFNO3 |
| Molecular Weight | 247.65 g/mol |
| Exact Mass | 247.04 |
| IUPAC Name | (4R)-4-amino-6-fluoro-3,4-dihydro-2H-chromene-8-carboxylic acid;hydrochloride |
| SMILES | Cl.N[C@@H]1CCOc2c(C(=O)O)cc(F)cc21 |
| InChI | InChI=1S/C10H10FNO3.ClH/c11-5-3-6-8(12)1-2-15-9(6)7(4-5)10(13)14;/h3-4,8H,1-2,12H2,(H,13,14);1H/t8-;/m1./s1 |
| InChIKey | MCTIBGVRZLUJFX-DDWIOCJRSA-N |
| XLogP | 1.73 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.65 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4R)-4-amino-6-fluoro-3,4-dihydro-2H-chromene-8-carboxylic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-4-amino-6-fluoro-3,4-dihydro-2H-chromene-8-carboxylic acid;hydrochloride?
The IUPAC name of (4R)-4-amino-6-fluoro-3,4-dihydro-2H-chromene-8-carboxylic acid;hydrochloride (CID 171252439) is (4R)-4-amino-6-fluoro-3,4-dihydro-2H-chromene-8-carboxylic acid;hydrochloride.
What is the SMILES notation for (4R)-4-amino-6-fluoro-3,4-dihydro-2H-chromene-8-carboxylic acid;hydrochloride?
The canonical SMILES for (4R)-4-amino-6-fluoro-3,4-dihydro-2H-chromene-8-carboxylic acid;hydrochloride is Cl.N[C@@H]1CCOc2c(C(=O)O)cc(F)cc21.
What is the InChIKey of (4R)-4-amino-6-fluoro-3,4-dihydro-2H-chromene-8-carboxylic acid;hydrochloride?
The InChIKey is MCTIBGVRZLUJFX-DDWIOCJRSA-N. The full InChI is InChI=1S/C10H10FNO3.ClH/c11-5-3-6-8(12)1-2-15-9(6)7(4-5)10(13)14;/h3-4,8H,1-2,12H2,(H,13,14);1H/t8-;/m1./s1.
What are the key properties of (4R)-4-amino-6-fluoro-3,4-dihydro-2H-chromene-8-carboxylic acid;hydrochloride?
(4R)-4-amino-6-fluoro-3,4-dihydro-2H-chromene-8-carboxylic acid;hydrochloride has a molecular weight of 247.65 g/mol, XLogP of 1.73, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-4-amino-6-fluoro-3,4-dihydro-2H-chromene-8-carboxylic acid;hydrochloride is sourced from PubChem (CID 171252439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).