C14H20ClNO3 — CID 171260832
4-[(1S,2S)-1-amino-2-cyclopentyl-1,2-dihydroxyethyl]benzaldehyde;hydrochloride (PubChem CID 171260832) has the molecular formula C14H20ClNO3 and a molecular weight of 285.77 g/mol. Its IUPAC name is 4-[(1S,2S)-1-amino-2-cyclopentyl-1,2-dihydroxyethyl]benzaldehyde;hydrochloride.
| Compound Name | 4-[(1S,2S)-1-amino-2-cyclopentyl-1,2-dihydroxyethyl]benzaldehyde;hydrochloride |
|---|---|
| PubChem CID | 171260832 |
| Molecular Formula | C14H20ClNO3 |
| Molecular Weight | 285.77 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | 4-[(1S,2S)-1-amino-2-cyclopentyl-1,2-dihydroxyethyl]benzaldehyde;hydrochloride |
| SMILES | Cl.N[C@](O)(c1ccc(C=O)cc1)[C@@H](O)C1CCCC1 |
| InChI | InChI=1S/C14H19NO3.ClH/c15-14(18,13(17)11-3-1-2-4-11)12-7-5-10(9-16)6-8-12;/h5-9,11,13,17-18H,1-4,15H2;1H/t13-,14-;/m0./s1 |
| InChIKey | SEYYNLQKGWXSMV-IODNYQNNSA-N |
| XLogP | 1.58 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.77 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|