C9H9F2NO2 — CID 131123262
4-[(1S)-1-amino-2,2-difluoro-1-hydroxyethyl]benzaldehyde (PubChem CID 131123262) has the molecular formula C9H9F2NO2 and a molecular weight of 201.17 g/mol. Its IUPAC name is 4-[(1S)-1-amino-2,2-difluoro-1-hydroxyethyl]benzaldehyde.
| Compound Name | 4-[(1S)-1-amino-2,2-difluoro-1-hydroxyethyl]benzaldehyde |
|---|---|
| PubChem CID | 131123262 |
| Molecular Formula | C9H9F2NO2 |
| Molecular Weight | 201.17 g/mol |
| Exact Mass | 201.06 |
| IUPAC Name | 4-[(1S)-1-amino-2,2-difluoro-1-hydroxyethyl]benzaldehyde |
| SMILES | N[C@](O)(c1ccc(C=O)cc1)C(F)F |
| InChI | InChI=1S/C9H9F2NO2/c10-8(11)9(12,14)7-3-1-6(5-13)2-4-7/h1-5,8,14H,12H2/t9-/m0/s1 |
| InChIKey | KEAJAZHQIONCPF-VIFPVBQESA-N |
| XLogP | 0.87 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.17 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|