C14H20BNO4 — CID 171191274
4-[(R)-amino-hydroxy-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]benzaldehyde (PubChem CID 171191274) has the molecular formula C14H20BNO4 and a molecular weight of 277.13 g/mol. Its IUPAC name is 4-[(R)-amino-hydroxy-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]benzaldehyde.
| Compound Name | 4-[(R)-amino-hydroxy-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]benzaldehyde |
|---|---|
| PubChem CID | 171191274 |
| Molecular Formula | C14H20BNO4 |
| Molecular Weight | 277.13 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | 4-[(R)-amino-hydroxy-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]benzaldehyde |
| SMILES | CC1(C)OB([C@@](N)(O)c2ccc(C=O)cc2)OC1(C)C |
| InChI | InChI=1S/C14H20BNO4/c1-12(2)13(3,4)20-15(19-12)14(16,18)11-7-5-10(9-17)6-8-11/h5-9,18H,16H2,1-4H3/t14-/m0/s1 |
| InChIKey | APQKBNNDODLLDE-AWEZNQCLSA-N |
| XLogP | 1.23 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.13 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|