C13H19NO3 — CID 171270418
4-[(1R,2R)-1-amino-2-hydroxy-1-methoxypentyl]benzaldehyde (PubChem CID 171270418) has the molecular formula C13H19NO3 and a molecular weight of 237.30 g/mol. Its IUPAC name is 4-[(1R,2R)-1-amino-2-hydroxy-1-methoxypentyl]benzaldehyde.
| Compound Name | 4-[(1R,2R)-1-amino-2-hydroxy-1-methoxypentyl]benzaldehyde |
|---|---|
| PubChem CID | 171270418 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | 4-[(1R,2R)-1-amino-2-hydroxy-1-methoxypentyl]benzaldehyde |
| SMILES | CCC[C@@H](O)[C@](N)(OC)c1ccc(C=O)cc1 |
| InChI | InChI=1S/C13H19NO3/c1-3-4-12(16)13(14,17-2)11-7-5-10(9-15)6-8-11/h5-9,12,16H,3-4,14H2,1-2H3/t12-,13-/m1/s1 |
| InChIKey | XLBZSCNRJWOZCR-CHWSQXEVSA-N |
| XLogP | 1.42 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|