C13H16O6 — CID 171867423
ethyl 3-(3-formylphenyl)-2,3-dihydroxy-3-methoxypropanoate (PubChem CID 171867423) has the molecular formula C13H16O6 and a molecular weight of 268.26 g/mol. Its IUPAC name is ethyl 3-(3-formylphenyl)-2,3-dihydroxy-3-methoxypropanoate.
| Compound Name | ethyl 3-(3-formylphenyl)-2,3-dihydroxy-3-methoxypropanoate |
|---|---|
| PubChem CID | 171867423 |
| Molecular Formula | C13H16O6 |
| Molecular Weight | 268.26 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | ethyl 3-(3-formylphenyl)-2,3-dihydroxy-3-methoxypropanoate |
| SMILES | CCOC(=O)C(O)C(O)(OC)c1cccc(C=O)c1 |
| InChI | InChI=1S/C13H16O6/c1-3-19-12(16)11(15)13(17,18-2)10-6-4-5-9(7-10)8-14/h4-8,11,15,17H,3H2,1-2H3 |
| InChIKey | QSFYUIIQARNRJS-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.26 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|