C15H24ClNO3 — CID 171270831
3-[(1R,2R)-1-amino-2-hydroxy-1-methoxy-5-methylhexyl]benzaldehyde;hydrochloride (PubChem CID 171270831) has the molecular formula C15H24ClNO3 and a molecular weight of 301.81 g/mol. Its IUPAC name is 3-[(1R,2R)-1-amino-2-hydroxy-1-methoxy-5-methylhexyl]benzaldehyde;hydrochloride.
| Compound Name | 3-[(1R,2R)-1-amino-2-hydroxy-1-methoxy-5-methylhexyl]benzaldehyde;hydrochloride |
|---|---|
| PubChem CID | 171270831 |
| Molecular Formula | C15H24ClNO3 |
| Molecular Weight | 301.81 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | 3-[(1R,2R)-1-amino-2-hydroxy-1-methoxy-5-methylhexyl]benzaldehyde;hydrochloride |
| SMILES | CO[C@](N)(c1cccc(C=O)c1)[C@H](O)CCC(C)C.Cl |
| InChI | InChI=1S/C15H23NO3.ClH/c1-11(2)7-8-14(18)15(16,19-3)13-6-4-5-12(9-13)10-17;/h4-6,9-11,14,18H,7-8,16H2,1-3H3;1H/t14-,15-;/m1./s1 |
| InChIKey | WUBJKTYNHFCQOJ-CTHHTMFSSA-N |
| XLogP | 2.48 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.81 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|