C15H25BrCl2N2O — CID 171273970
1-[(S)-(5-bromofuran-2-yl)-cyclohexylmethyl]piperazine;dihydrochloride (PubChem CID 171273970) has the molecular formula C15H25BrCl2N2O and a molecular weight of 400.19 g/mol. Its IUPAC name is 1-[(S)-(5-bromofuran-2-yl)-cyclohexylmethyl]piperazine;dihydrochloride.
| Compound Name | 1-[(S)-(5-bromofuran-2-yl)-cyclohexylmethyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171273970 |
| Molecular Formula | C15H25BrCl2N2O |
| Molecular Weight | 400.19 g/mol |
| Exact Mass | 398.05 |
| IUPAC Name | 1-[(S)-(5-bromofuran-2-yl)-cyclohexylmethyl]piperazine;dihydrochloride |
| SMILES | Brc1ccc(C(C2CCCCC2)N2CCNCC2)o1.Cl.Cl |
| InChI | InChI=1S/C15H23BrN2O.2ClH/c16-14-7-6-13(19-14)15(12-4-2-1-3-5-12)18-10-8-17-9-11-18;;/h6-7,12,15,17H,1-5,8-11H2;2*1H |
| InChIKey | MXLDKGGABCIXRA-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 28.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.19 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |