C11H17FN4 — CID 171281215
3-[(1R)-2-fluoro-1-piperazin-1-ylethyl]pyridin-2-amine (PubChem CID 171281215) has the molecular formula C11H17FN4 and a molecular weight of 224.28 g/mol. Its IUPAC name is 3-[(1R)-2-fluoro-1-piperazin-1-ylethyl]pyridin-2-amine.
| Compound Name | 3-[(1R)-2-fluoro-1-piperazin-1-ylethyl]pyridin-2-amine |
|---|---|
| PubChem CID | 171281215 |
| Molecular Formula | C11H17FN4 |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | 3-[(1R)-2-fluoro-1-piperazin-1-ylethyl]pyridin-2-amine |
| SMILES | Nc1ncccc1[C@H](CF)N1CCNCC1 |
| InChI | InChI=1S/C11H17FN4/c12-8-10(16-6-4-14-5-7-16)9-2-1-3-15-11(9)13/h1-3,10,14H,4-8H2,(H2,13,15)/t10-/m0/s1 |
| InChIKey | BIPKUJSCFOWXKK-JTQLQIEISA-N |
| XLogP | 0.58 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |