C12H19Cl2N5 — CID 171307032
(3R)-3-(2-amino-3-pyridinyl)-3-piperazin-1-ylpropanenitrile;dihydrochloride (PubChem CID 171307032) has the molecular formula C12H19Cl2N5 and a molecular weight of 304.22 g/mol. Its IUPAC name is (3R)-3-(2-amino-3-pyridinyl)-3-piperazin-1-ylpropanenitrile;dihydrochloride.
| Compound Name | (3R)-3-(2-amino-3-pyridinyl)-3-piperazin-1-ylpropanenitrile;dihydrochloride |
|---|---|
| PubChem CID | 171307032 |
| Molecular Formula | C12H19Cl2N5 |
| Molecular Weight | 304.22 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | (3R)-3-(2-amino-3-pyridinyl)-3-piperazin-1-ylpropanenitrile;dihydrochloride |
| SMILES | Cl.Cl.N#CC[C@H](c1cccnc1N)N1CCNCC1 |
| InChI | InChI=1S/C12H17N5.2ClH/c13-4-3-11(17-8-6-15-7-9-17)10-2-1-5-16-12(10)14;;/h1-2,5,11,15H,3,6-9H2,(H2,14,16);2*1H/t11-;;/m1../s1 |
| InChIKey | KPCCHNRFNDKVGR-NVJADKKVSA-N |
| XLogP | 1.37 |
| TPSA | 77.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.22 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |