About 1-[(1R)-2,2-difluoro-1-(1-methylpyrrol-2-yl)ethyl]piperazine;dihydrochloride
1-[(1R)-2,2-difluoro-1-(1-methylpyrrol-2-yl)ethyl]piperazine;dihydrochloride (PubChem CID 171281880) has the molecular formula C11H19Cl2F2N3
and a molecular weight of 302.20 g/mol. Its IUPAC name is 1-[(1R)-2,2-difluoro-1-(1-methylpyrrol-2-yl)ethyl]piperazine;dihydrochloride.
Molecular Properties
| Compound Name | 1-[(1R)-2,2-difluoro-1-(1-methylpyrrol-2-yl)ethyl]piperazine;dihydrochloride |
| PubChem CID | 171281880 |
| Molecular Formula | C11H19Cl2F2N3 |
| Molecular Weight | 302.20 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | 1-[(1R)-2,2-difluoro-1-(1-methylpyrrol-2-yl)ethyl]piperazine;dihydrochloride |
| SMILES | Cl.Cl.Cn1cccc1[C@H](C(F)F)N1CCNCC1 |
| InChI | InChI=1S/C11H17F2N3.2ClH/c1-15-6-2-3-9(15)10(11(12)13)16-7-4-14-5-8-16;;/h2-3,6,10-11,14H,4-5,7-8H2,1H3;2*1H/t10-;;/m1../s1 |
| InChIKey | SBUBSSKVGNNMTE-YQFADDPSSA-N |
| XLogP | 2.08 |
| TPSA | 20.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.20 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(1R)-2,2-difluoro-1-(1-methylpyrrol-2-yl)ethyl]piperazine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1R)-2,2-difluoro-1-(1-methylpyrrol-2-yl)ethyl]piperazine;dihydrochloride?
The IUPAC name of 1-[(1R)-2,2-difluoro-1-(1-methylpyrrol-2-yl)ethyl]piperazine;dihydrochloride (CID 171281880) is 1-[(1R)-2,2-difluoro-1-(1-methylpyrrol-2-yl)ethyl]piperazine;dihydrochloride.
What is the SMILES notation for 1-[(1R)-2,2-difluoro-1-(1-methylpyrrol-2-yl)ethyl]piperazine;dihydrochloride?
The canonical SMILES for 1-[(1R)-2,2-difluoro-1-(1-methylpyrrol-2-yl)ethyl]piperazine;dihydrochloride is Cl.Cl.Cn1cccc1[C@H](C(F)F)N1CCNCC1.
What is the InChIKey of 1-[(1R)-2,2-difluoro-1-(1-methylpyrrol-2-yl)ethyl]piperazine;dihydrochloride?
The InChIKey is SBUBSSKVGNNMTE-YQFADDPSSA-N. The full InChI is InChI=1S/C11H17F2N3.2ClH/c1-15-6-2-3-9(15)10(11(12)13)16-7-4-14-5-8-16;;/h2-3,6,10-11,14H,4-5,7-8H2,1H3;2*1H/t10-;;/m1../s1.
What are the key properties of 1-[(1R)-2,2-difluoro-1-(1-methylpyrrol-2-yl)ethyl]piperazine;dihydrochloride?
1-[(1R)-2,2-difluoro-1-(1-methylpyrrol-2-yl)ethyl]piperazine;dihydrochloride has a molecular weight of 302.20 g/mol, XLogP of 2.08, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1R)-2,2-difluoro-1-(1-methylpyrrol-2-yl)ethyl]piperazine;dihydrochloride is sourced from PubChem (CID 171281880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).