C11H16F3N3 — CID 171294498
1-[(1S)-2,2,2-trifluoro-1-(1-methylpyrrol-2-yl)ethyl]piperazine (PubChem CID 171294498) has the molecular formula C11H16F3N3 and a molecular weight of 247.26 g/mol. Its IUPAC name is 1-[(1S)-2,2,2-trifluoro-1-(1-methylpyrrol-2-yl)ethyl]piperazine.
| Compound Name | 1-[(1S)-2,2,2-trifluoro-1-(1-methylpyrrol-2-yl)ethyl]piperazine |
|---|---|
| PubChem CID | 171294498 |
| Molecular Formula | C11H16F3N3 |
| Molecular Weight | 247.26 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | 1-[(1S)-2,2,2-trifluoro-1-(1-methylpyrrol-2-yl)ethyl]piperazine |
| SMILES | Cn1cccc1[C@H](N1CCNCC1)C(F)(F)F |
| InChI | InChI=1S/C11H16F3N3/c1-16-6-2-3-9(16)10(11(12,13)14)17-7-4-15-5-8-17/h2-3,6,10,15H,4-5,7-8H2,1H3/t10-/m0/s1 |
| InChIKey | OIANLPFUMNSDFC-JTQLQIEISA-N |
| XLogP | 1.53 |
| TPSA | 20.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.26 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |