C10H13F3N2O — CID 131475959
1-[(1S)-2,2,2-trifluoro-1-(furan-2-yl)ethyl]piperazine (PubChem CID 131475959) has the molecular formula C10H13F3N2O and a molecular weight of 234.22 g/mol. Its IUPAC name is 1-[(1S)-2,2,2-trifluoro-1-(furan-2-yl)ethyl]piperazine.
| Compound Name | 1-[(1S)-2,2,2-trifluoro-1-(furan-2-yl)ethyl]piperazine |
|---|---|
| PubChem CID | 131475959 |
| Molecular Formula | C10H13F3N2O |
| Molecular Weight | 234.22 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | 1-[(1S)-2,2,2-trifluoro-1-(furan-2-yl)ethyl]piperazine |
| SMILES | FC(F)(F)[C@H](c1ccco1)N1CCNCC1 |
| InChI | InChI=1S/C10H13F3N2O/c11-10(12,13)9(8-2-1-7-16-8)15-5-3-14-4-6-15/h1-2,7,9,14H,3-6H2/t9-/m0/s1 |
| InChIKey | PSYHFOMMPLBKDE-VIFPVBQESA-N |
| XLogP | 1.79 |
| TPSA | 28.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.22 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |