C17H30Cl2N2O — CID 171287107
1-[(1R)-1-(4-ethoxyphenyl)-2,2-dimethylpropyl]piperazine;dihydrochloride (PubChem CID 171287107) has the molecular formula C17H30Cl2N2O and a molecular weight of 349.35 g/mol. Its IUPAC name is 1-[(1R)-1-(4-ethoxyphenyl)-2,2-dimethylpropyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1R)-1-(4-ethoxyphenyl)-2,2-dimethylpropyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171287107 |
| Molecular Formula | C17H30Cl2N2O |
| Molecular Weight | 349.35 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | 1-[(1R)-1-(4-ethoxyphenyl)-2,2-dimethylpropyl]piperazine;dihydrochloride |
| SMILES | CCOc1ccc([C@H](N2CCNCC2)C(C)(C)C)cc1.Cl.Cl |
| InChI | InChI=1S/C17H28N2O.2ClH/c1-5-20-15-8-6-14(7-9-15)16(17(2,3)4)19-12-10-18-11-13-19;;/h6-9,16,18H,5,10-13H2,1-4H3;2*1H/t16-;;/m0../s1 |
| InChIKey | DNOYFUKOUOAIDL-SQKCAUCHSA-N |
| XLogP | 3.92 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.35 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |