C16H18N2O2S — CID 171294843
1-[(S)-1,3-benzodioxol-4-yl(thiophen-2-yl)methyl]piperazine (PubChem CID 171294843) has the molecular formula C16H18N2O2S and a molecular weight of 302.40 g/mol. Its IUPAC name is 1-[(S)-1,3-benzodioxol-4-yl(thiophen-2-yl)methyl]piperazine.
| Compound Name | 1-[(S)-1,3-benzodioxol-4-yl(thiophen-2-yl)methyl]piperazine |
|---|---|
| PubChem CID | 171294843 |
| Molecular Formula | C16H18N2O2S |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | 1-[(S)-1,3-benzodioxol-4-yl(thiophen-2-yl)methyl]piperazine |
| SMILES | c1csc([C@H](c2cccc3c2OCO3)N2CCNCC2)c1 |
| InChI | InChI=1S/C16H18N2O2S/c1-3-12(16-13(4-1)19-11-20-16)15(14-5-2-10-21-14)18-8-6-17-7-9-18/h1-5,10,15,17H,6-9,11H2/t15-/m0/s1 |
| InChIKey | QXLXKIKBRYIPIS-HNNXBMFYSA-N |
| XLogP | 2.47 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |