C21H24N2O4 — CID 17129627
3-[[2-(furan-2-ylmethylideneamino)phenyl]carbamoyl]-1,2,2-trimethylcyclopentane-1-carboxylic acid (PubChem CID 17129627) has the molecular formula C21H24N2O4 and a molecular weight of 368.43 g/mol. Its IUPAC name is 3-[[2-(furan-2-ylmethylideneamino)phenyl]carbamoyl]-1,2,2-trimethylcyclopentane-1-carboxylic acid.
| Compound Name | 3-[[2-(furan-2-ylmethylideneamino)phenyl]carbamoyl]-1,2,2-trimethylcyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 17129627 |
| Molecular Formula | C21H24N2O4 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | 3-[[2-(furan-2-ylmethylideneamino)phenyl]carbamoyl]-1,2,2-trimethylcyclopentane-1-carboxylic acid |
| SMILES | CC1(C(=O)O)CCC(C(=O)Nc2ccccc2/N=C/c2ccco2)C1(C)C |
| InChI | InChI=1S/C21H24N2O4/c1-20(2)15(10-11-21(20,3)19(25)26)18(24)23-17-9-5-4-8-16(17)22-13-14-7-6-12-27-14/h4-9,12-13,15H,10-11H2,1-3H3,(H,23,24)(H,25,26)/b22-13+ |
| InChIKey | YROWHPSBSDNVDW-LPYMAVHISA-N |
| XLogP | 4.50 |
| TPSA | 91.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|