C23H24BrN2O3- — CID 2430958
cis-(1S,3S)-3-[[2-[(4-bromophenyl)methylideneamino]phenyl]carbamoyl]-1,2,2-trimethylcyclopentane-1-carboxylate (PubChem CID 2430958) has the molecular formula C23H24BrN2O3- and a molecular weight of 456.36 g/mol. Its IUPAC name is cis-(1S,3S)-3-[[2-[(4-bromophenyl)methylideneamino]phenyl]carbamoyl]-1,2,2-trimethylcyclopentane-1-carboxylate.
| Compound Name | cis-(1S,3S)-3-[[2-[(4-bromophenyl)methylideneamino]phenyl]carbamoyl]-1,2,2-trimethylcyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 2430958 |
| Molecular Formula | C23H24BrN2O3- |
| Molecular Weight | 456.36 g/mol |
| Exact Mass | 455.10 |
| IUPAC Name | cis-(1S,3S)-3-[[2-[(4-bromophenyl)methylideneamino]phenyl]carbamoyl]-1,2,2-trimethylcyclopentane-1-carboxylate |
| SMILES | CC1(C)[C@@H](C(=O)Nc2ccccc2/N=C/c2ccc(Br)cc2)CC[C@]1(C)C(=O)[O-] |
| InChI | InChI=1S/C23H25BrN2O3/c1-22(2)17(12-13-23(22,3)21(28)29)20(27)26-19-7-5-4-6-18(19)25-14-15-8-10-16(24)11-9-15/h4-11,14,17H,12-13H2,1-3H3,(H,26,27)(H,28,29)/p-1/b25-14+/t17-,23-/m1/s1 |
| InChIKey | CDDDKEJJDCTFII-PXMKGOGNSA-M |
| XLogP | 4.33 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.36 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|