C23H26N2O4 — CID 17129632
3-[[2-[(3-hydroxyphenyl)methylideneamino]phenyl]carbamoyl]-1,2,2-trimethylcyclopentane-1-carboxylic acid (PubChem CID 17129632) has the molecular formula C23H26N2O4 and a molecular weight of 394.47 g/mol. Its IUPAC name is 3-[[2-[(3-hydroxyphenyl)methylideneamino]phenyl]carbamoyl]-1,2,2-trimethylcyclopentane-1-carboxylic acid.
| Compound Name | 3-[[2-[(3-hydroxyphenyl)methylideneamino]phenyl]carbamoyl]-1,2,2-trimethylcyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 17129632 |
| Molecular Formula | C23H26N2O4 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | 3-[[2-[(3-hydroxyphenyl)methylideneamino]phenyl]carbamoyl]-1,2,2-trimethylcyclopentane-1-carboxylic acid |
| SMILES | CC1(C(=O)O)CCC(C(=O)Nc2ccccc2/N=C/c2cccc(O)c2)C1(C)C |
| InChI | InChI=1S/C23H26N2O4/c1-22(2)17(11-12-23(22,3)21(28)29)20(27)25-19-10-5-4-9-18(19)24-14-15-7-6-8-16(26)13-15/h4-10,13-14,17,26H,11-12H2,1-3H3,(H,25,27)(H,28,29)/b24-14+ |
| InChIKey | XQZPZYASZKHTSA-ZVHZXABRSA-N |
| XLogP | 4.61 |
| TPSA | 98.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|