C14H20Cl2FN3O3 — CID 171299007
2-fluoro-4-nitro-6-[(1S)-1-piperazin-1-ylbut-3-enyl]phenol;dihydrochloride (PubChem CID 171299007) has the molecular formula C14H20Cl2FN3O3 and a molecular weight of 368.24 g/mol. Its IUPAC name is 2-fluoro-4-nitro-6-[(1S)-1-piperazin-1-ylbut-3-enyl]phenol;dihydrochloride.
| Compound Name | 2-fluoro-4-nitro-6-[(1S)-1-piperazin-1-ylbut-3-enyl]phenol;dihydrochloride |
|---|---|
| PubChem CID | 171299007 |
| Molecular Formula | C14H20Cl2FN3O3 |
| Molecular Weight | 368.24 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | 2-fluoro-4-nitro-6-[(1S)-1-piperazin-1-ylbut-3-enyl]phenol;dihydrochloride |
| SMILES | C=CC[C@@H](c1cc([N+](=O)[O-])cc(F)c1O)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C14H18FN3O3.2ClH/c1-2-3-13(17-6-4-16-5-7-17)11-8-10(18(20)21)9-12(15)14(11)19;;/h2,8-9,13,16,19H,1,3-7H2;2*1H/t13-;;/m0../s1 |
| InChIKey | UFHZDUKFKBRUAT-GXKRWWSZSA-N |
| XLogP | 2.81 |
| TPSA | 78.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.24 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|