C16H25Cl2F3N2O2 — CID 171299347
2-[(1S)-3-methyl-1-piperazin-1-ylbutyl]-6-(trifluoromethoxy)phenol;dihydrochloride (PubChem CID 171299347) has the molecular formula C16H25Cl2F3N2O2 and a molecular weight of 405.29 g/mol. Its IUPAC name is 2-[(1S)-3-methyl-1-piperazin-1-ylbutyl]-6-(trifluoromethoxy)phenol;dihydrochloride.
| Compound Name | 2-[(1S)-3-methyl-1-piperazin-1-ylbutyl]-6-(trifluoromethoxy)phenol;dihydrochloride |
|---|---|
| PubChem CID | 171299347 |
| Molecular Formula | C16H25Cl2F3N2O2 |
| Molecular Weight | 405.29 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | 2-[(1S)-3-methyl-1-piperazin-1-ylbutyl]-6-(trifluoromethoxy)phenol;dihydrochloride |
| SMILES | CC(C)C[C@@H](c1cccc(OC(F)(F)F)c1O)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C16H23F3N2O2.2ClH/c1-11(2)10-13(21-8-6-20-7-9-21)12-4-3-5-14(15(12)22)23-16(17,18)19;;/h3-5,11,13,20,22H,6-10H2,1-2H3;2*1H/t13-;;/m0../s1 |
| InChIKey | ZUKIOCVCMYXVOV-GXKRWWSZSA-N |
| XLogP | 4.13 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.29 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|