C12H15Br2FN2O — CID 171299804
3,5-dibromo-2-[(1S)-2-fluoro-1-piperazin-1-ylethyl]phenol (PubChem CID 171299804) has the molecular formula C12H15Br2FN2O and a molecular weight of 382.07 g/mol. Its IUPAC name is 3,5-dibromo-2-[(1S)-2-fluoro-1-piperazin-1-ylethyl]phenol.
| Compound Name | 3,5-dibromo-2-[(1S)-2-fluoro-1-piperazin-1-ylethyl]phenol |
|---|---|
| PubChem CID | 171299804 |
| Molecular Formula | C12H15Br2FN2O |
| Molecular Weight | 382.07 g/mol |
| Exact Mass | 379.95 |
| IUPAC Name | 3,5-dibromo-2-[(1S)-2-fluoro-1-piperazin-1-ylethyl]phenol |
| SMILES | Oc1cc(Br)cc(Br)c1[C@@H](CF)N1CCNCC1 |
| InChI | InChI=1S/C12H15Br2FN2O/c13-8-5-9(14)12(11(18)6-8)10(7-15)17-3-1-16-2-4-17/h5-6,10,16,18H,1-4,7H2/t10-/m1/s1 |
| InChIKey | DQJMIWSXZGAKJY-SNVBAGLBSA-N |
| XLogP | 2.83 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.07 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|