C17H28Cl2N2O3 — CID 171308482
1-[(1R)-1-(7-methoxy-1,3-benzodioxol-5-yl)pentyl]piperazine;dihydrochloride (PubChem CID 171308482) has the molecular formula C17H28Cl2N2O3 and a molecular weight of 379.33 g/mol. Its IUPAC name is 1-[(1R)-1-(7-methoxy-1,3-benzodioxol-5-yl)pentyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1R)-1-(7-methoxy-1,3-benzodioxol-5-yl)pentyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171308482 |
| Molecular Formula | C17H28Cl2N2O3 |
| Molecular Weight | 379.33 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | 1-[(1R)-1-(7-methoxy-1,3-benzodioxol-5-yl)pentyl]piperazine;dihydrochloride |
| SMILES | CCCC[C@H](c1cc(OC)c2c(c1)OCO2)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C17H26N2O3.2ClH/c1-3-4-5-14(19-8-6-18-7-9-19)13-10-15(20-2)17-16(11-13)21-12-22-17;;/h10-11,14,18H,3-9,12H2,1-2H3;2*1H/t14-;;/m1../s1 |
| InChIKey | IORLAZIJQGHLOJ-FMOMHUKBSA-N |
| XLogP | 3.40 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.33 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |