C14H23BrN2O — CID 171309929
1-[(1S)-1-(5-bromofuran-2-yl)-4-methylpentyl]piperazine (PubChem CID 171309929) has the molecular formula C14H23BrN2O and a molecular weight of 315.25 g/mol. Its IUPAC name is 1-[(1S)-1-(5-bromofuran-2-yl)-4-methylpentyl]piperazine.
| Compound Name | 1-[(1S)-1-(5-bromofuran-2-yl)-4-methylpentyl]piperazine |
|---|---|
| PubChem CID | 171309929 |
| Molecular Formula | C14H23BrN2O |
| Molecular Weight | 315.25 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | 1-[(1S)-1-(5-bromofuran-2-yl)-4-methylpentyl]piperazine |
| SMILES | CC(C)CC[C@@H](c1ccc(Br)o1)N1CCNCC1 |
| InChI | InChI=1S/C14H23BrN2O/c1-11(2)3-4-12(13-5-6-14(15)18-13)17-9-7-16-8-10-17/h5-6,11-12,16H,3-4,7-10H2,1-2H3/t12-/m0/s1 |
| InChIKey | JLXDSCQMIOBTCN-LBPRGKRZSA-N |
| XLogP | 3.42 |
| TPSA | 28.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.25 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |