C22H36N4O5 — CID 171318047
4-[(3R)-3-(cyclopentylmethyl)-2-oxopiperidin-1-yl]-N-hydroxy-N-[(3,4,4-trimethyl-2,5-dioxoimidazolidin-1-yl)methyl]butanamide (PubChem CID 171318047) has the molecular formula C22H36N4O5 and a molecular weight of 436.55 g/mol. Its IUPAC name is 4-[(3R)-3-(cyclopentylmethyl)-2-oxopiperidin-1-yl]-N-hydroxy-N-[(3,4,4-trimethyl-2,5-dioxoimidazolidin-1-yl)methyl]butanamide.
| Compound Name | 4-[(3R)-3-(cyclopentylmethyl)-2-oxopiperidin-1-yl]-N-hydroxy-N-[(3,4,4-trimethyl-2,5-dioxoimidazolidin-1-yl)methyl]butanamide |
|---|---|
| PubChem CID | 171318047 |
| Molecular Formula | C22H36N4O5 |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 436.27 |
| IUPAC Name | 4-[(3R)-3-(cyclopentylmethyl)-2-oxopiperidin-1-yl]-N-hydroxy-N-[(3,4,4-trimethyl-2,5-dioxoimidazolidin-1-yl)methyl]butanamide |
| SMILES | CN1C(=O)N(CN(O)C(=O)CCCN2CCC[C@H](CC3CCCC3)C2=O)C(=O)C1(C)C |
| InChI | InChI=1S/C22H36N4O5/c1-22(2)20(29)25(21(30)23(22)3)15-26(31)18(27)11-7-13-24-12-6-10-17(19(24)28)14-16-8-4-5-9-16/h16-17,31H,4-15H2,1-3H3/t17-/m1/s1 |
| InChIKey | VIJJVIOOBYUEIS-QGZVFWFLSA-N |
| XLogP | 2.43 |
| TPSA | 101.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|