C18H25FN2O4 — CID 171321497
3-(2-fluorophenyl)-1-[(1S,5R)-9-methyl-3-oxa-7,9-diazabicyclo[3.3.2]decan-7-yl]propan-1-one;formic acid (PubChem CID 171321497) has the molecular formula C18H25FN2O4 and a molecular weight of 352.41 g/mol. Its IUPAC name is 3-(2-fluorophenyl)-1-[(1S,5R)-9-methyl-3-oxa-7,9-diazabicyclo[3.3.2]decan-7-yl]propan-1-one;formic acid.
| Compound Name | 3-(2-fluorophenyl)-1-[(1S,5R)-9-methyl-3-oxa-7,9-diazabicyclo[3.3.2]decan-7-yl]propan-1-one;formic acid |
|---|---|
| PubChem CID | 171321497 |
| Molecular Formula | C18H25FN2O4 |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | 3-(2-fluorophenyl)-1-[(1S,5R)-9-methyl-3-oxa-7,9-diazabicyclo[3.3.2]decan-7-yl]propan-1-one;formic acid |
| SMILES | CN1C[C@H]2COC[C@@H]1CN(C(=O)CCc1ccccc1F)C2.O=CO |
| InChI | InChI=1S/C17H23FN2O2.CH2O2/c1-19-8-13-9-20(10-15(19)12-22-11-13)17(21)7-6-14-4-2-3-5-16(14)18;2-1-3/h2-5,13,15H,6-12H2,1H3;1H,(H,2,3)/t13-,15+;/m1./s1 |
| InChIKey | MCACHZZBLRLBOL-PBCQUBLHSA-N |
| XLogP | 1.25 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|