C13H15ClFN3S — CID 171323348
3-(3-fluorophenyl)-1,4,8-triazaspiro[4.5]dec-3-ene-2-thione;hydrochloride (PubChem CID 171323348) has the molecular formula C13H15ClFN3S and a molecular weight of 299.80 g/mol. Its IUPAC name is 3-(3-fluorophenyl)-1,4,8-triazaspiro[4.5]dec-3-ene-2-thione;hydrochloride.
| Compound Name | 3-(3-fluorophenyl)-1,4,8-triazaspiro[4.5]dec-3-ene-2-thione;hydrochloride |
|---|---|
| PubChem CID | 171323348 |
| Molecular Formula | C13H15ClFN3S |
| Molecular Weight | 299.80 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | 3-(3-fluorophenyl)-1,4,8-triazaspiro[4.5]dec-3-ene-2-thione;hydrochloride |
| SMILES | Cl.Fc1cccc(C2=NC3(CCNCC3)NC2=S)c1 |
| InChI | InChI=1S/C13H14FN3S.ClH/c14-10-3-1-2-9(8-10)11-12(18)17-13(16-11)4-6-15-7-5-13;/h1-3,8,15H,4-7H2,(H,17,18);1H |
| InChIKey | XIGBDQSVRYBQAY-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.80 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|