C13H14ClN3O — CID 97032835
3-(3-chlorophenyl)-1,4,8-triazaspiro[4.5]dec-3-en-2-one (PubChem CID 97032835) has the molecular formula C13H14ClN3O and a molecular weight of 263.73 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-1,4,8-triazaspiro[4.5]dec-3-en-2-one.
| Compound Name | 3-(3-chlorophenyl)-1,4,8-triazaspiro[4.5]dec-3-en-2-one |
|---|---|
| PubChem CID | 97032835 |
| Molecular Formula | C13H14ClN3O |
| Molecular Weight | 263.73 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | 3-(3-chlorophenyl)-1,4,8-triazaspiro[4.5]dec-3-en-2-one |
| SMILES | O=C1NC2(CCNCC2)N=C1c1cccc(Cl)c1 |
| InChI | InChI=1S/C13H14ClN3O/c14-10-3-1-2-9(8-10)11-12(18)17-13(16-11)4-6-15-7-5-13/h1-3,8,15H,4-7H2,(H,17,18) |
| InChIKey | UBNZJLUBMGUMAH-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.73 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |