C14H16F3N3OS — CID 171323585
thiomorpholin-4-yl-[1-[6-(trifluoromethyl)-3-pyridinyl]azetidin-3-yl]methanone (PubChem CID 171323585) has the molecular formula C14H16F3N3OS and a molecular weight of 331.36 g/mol. Its IUPAC name is thiomorpholin-4-yl-[1-[6-(trifluoromethyl)-3-pyridinyl]azetidin-3-yl]methanone.
| Compound Name | thiomorpholin-4-yl-[1-[6-(trifluoromethyl)-3-pyridinyl]azetidin-3-yl]methanone |
|---|---|
| PubChem CID | 171323585 |
| Molecular Formula | C14H16F3N3OS |
| Molecular Weight | 331.36 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | thiomorpholin-4-yl-[1-[6-(trifluoromethyl)-3-pyridinyl]azetidin-3-yl]methanone |
| SMILES | O=C(C1CN(c2ccc(C(F)(F)F)nc2)C1)N1CCSCC1 |
| InChI | InChI=1S/C14H16F3N3OS/c15-14(16,17)12-2-1-11(7-18-12)20-8-10(9-20)13(21)19-3-5-22-6-4-19/h1-2,7,10H,3-6,8-9H2 |
| InChIKey | KTFHNXFZHVJFNX-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.36 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |