C18H22N4O — CID 171328105
8-cyclopentyl-2-(3,6-dihydro-2H-pyridin-1-yl)-5-methylpyrido[2,3-d]pyrimidin-7-one (PubChem CID 171328105) has the molecular formula C18H22N4O and a molecular weight of 310.40 g/mol. Its IUPAC name is 8-cyclopentyl-2-(3,6-dihydro-2H-pyridin-1-yl)-5-methylpyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 8-cyclopentyl-2-(3,6-dihydro-2H-pyridin-1-yl)-5-methylpyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 171328105 |
| Molecular Formula | C18H22N4O |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | 8-cyclopentyl-2-(3,6-dihydro-2H-pyridin-1-yl)-5-methylpyrido[2,3-d]pyrimidin-7-one |
| SMILES | Cc1cc(=O)n(C2CCCC2)c2nc(N3CC=CCC3)ncc12 |
| InChI | InChI=1S/C18H22N4O/c1-13-11-16(23)22(14-7-3-4-8-14)17-15(13)12-19-18(20-17)21-9-5-2-6-10-21/h2,5,11-12,14H,3-4,6-10H2,1H3 |
| InChIKey | RBUTVDKOHGNNLU-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|