C18H19FN4O7 — CID 171330001
formic acid;methyl 5-[[(3S,5R)-5-fluoro-1-(furan-2-carbonyl)piperidin-3-yl]carbamoyl]pyrazine-2-carboxylate (PubChem CID 171330001) has the molecular formula C18H19FN4O7 and a molecular weight of 422.37 g/mol. Its IUPAC name is formic acid;methyl 5-[[(3S,5R)-5-fluoro-1-(furan-2-carbonyl)piperidin-3-yl]carbamoyl]pyrazine-2-carboxylate.
| Compound Name | formic acid;methyl 5-[[(3S,5R)-5-fluoro-1-(furan-2-carbonyl)piperidin-3-yl]carbamoyl]pyrazine-2-carboxylate |
|---|---|
| PubChem CID | 171330001 |
| Molecular Formula | C18H19FN4O7 |
| Molecular Weight | 422.37 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | formic acid;methyl 5-[[(3S,5R)-5-fluoro-1-(furan-2-carbonyl)piperidin-3-yl]carbamoyl]pyrazine-2-carboxylate |
| SMILES | COC(=O)c1cnc(C(=O)N[C@H]2C[C@@H](F)CN(C(=O)c3ccco3)C2)cn1.O=CO |
| InChI | InChI=1S/C17H17FN4O5.CH2O2/c1-26-17(25)13-7-19-12(6-20-13)15(23)21-11-5-10(18)8-22(9-11)16(24)14-3-2-4-27-14;2-1-3/h2-4,6-7,10-11H,5,8-9H2,1H3,(H,21,23);1H,(H,2,3)/t10-,11+;/m1./s1 |
| InChIKey | SAKPYIYEOKUJQF-DHXVBOOMSA-N |
| XLogP | 0.54 |
| TPSA | 151.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.37 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|