C20H14N6O3S2 — CID 171333627
2-cyano-3-[4-[(2-methyl-5-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-yl)methoxy]phenyl]-N-(1,3-thiazol-2-yl)prop-2-enamide (PubChem CID 171333627) has the molecular formula C20H14N6O3S2 and a molecular weight of 450.51 g/mol. Its IUPAC name is 2-cyano-3-[4-[(2-methyl-5-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-yl)methoxy]phenyl]-N-(1,3-thiazol-2-yl)prop-2-enamide.
| Compound Name | 2-cyano-3-[4-[(2-methyl-5-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-yl)methoxy]phenyl]-N-(1,3-thiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 171333627 |
| Molecular Formula | C20H14N6O3S2 |
| Molecular Weight | 450.51 g/mol |
| Exact Mass | 450.06 |
| IUPAC Name | 2-cyano-3-[4-[(2-methyl-5-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-yl)methoxy]phenyl]-N-(1,3-thiazol-2-yl)prop-2-enamide |
| SMILES | Cc1nn2c(=O)cc(COc3ccc(C=C(C#N)C(=O)Nc4nccs4)cc3)nc2s1 |
| InChI | InChI=1S/C20H14N6O3S2/c1-12-25-26-17(27)9-15(23-20(26)31-12)11-29-16-4-2-13(3-5-16)8-14(10-21)18(28)24-19-22-6-7-30-19/h2-9H,11H2,1H3,(H,22,24,28) |
| InChIKey | ZJBDIRJFEZVMGN-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 122.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.51 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|