C22H18N6O4S — CID 171333654
2-cyano-3-[4-[(2-ethyl-5-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-yl)methoxy]phenyl]-N-(5-methyl-1,2-oxazol-3-yl)prop-2-enamide (PubChem CID 171333654) has the molecular formula C22H18N6O4S and a molecular weight of 462.49 g/mol. Its IUPAC name is 2-cyano-3-[4-[(2-ethyl-5-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-yl)methoxy]phenyl]-N-(5-methyl-1,2-oxazol-3-yl)prop-2-enamide.
| Compound Name | 2-cyano-3-[4-[(2-ethyl-5-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-yl)methoxy]phenyl]-N-(5-methyl-1,2-oxazol-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 171333654 |
| Molecular Formula | C22H18N6O4S |
| Molecular Weight | 462.49 g/mol |
| Exact Mass | 462.11 |
| IUPAC Name | 2-cyano-3-[4-[(2-ethyl-5-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-yl)methoxy]phenyl]-N-(5-methyl-1,2-oxazol-3-yl)prop-2-enamide |
| SMILES | CCc1nn2c(=O)cc(COc3ccc(C=C(C#N)C(=O)Nc4cc(C)on4)cc3)nc2s1 |
| InChI | InChI=1S/C22H18N6O4S/c1-3-19-26-28-20(29)10-16(24-22(28)33-19)12-31-17-6-4-14(5-7-17)9-15(11-23)21(30)25-18-8-13(2)32-27-18/h4-10H,3,12H2,1-2H3,(H,25,27,30) |
| InChIKey | LZUNPSMBVFKYDJ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 135.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.49 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|