C18H21FN6 — CID 171334594
4-[4-[2-(ethylamino)-6-methylpyrimidin-4-yl]piperazin-1-yl]-2-fluorobenzonitrile (PubChem CID 171334594) has the molecular formula C18H21FN6 and a molecular weight of 340.41 g/mol. Its IUPAC name is 4-[4-[2-(ethylamino)-6-methylpyrimidin-4-yl]piperazin-1-yl]-2-fluorobenzonitrile.
| Compound Name | 4-[4-[2-(ethylamino)-6-methylpyrimidin-4-yl]piperazin-1-yl]-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 171334594 |
| Molecular Formula | C18H21FN6 |
| Molecular Weight | 340.41 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | 4-[4-[2-(ethylamino)-6-methylpyrimidin-4-yl]piperazin-1-yl]-2-fluorobenzonitrile |
| SMILES | CCNc1nc(C)cc(N2CCN(c3ccc(C#N)c(F)c3)CC2)n1 |
| InChI | InChI=1S/C18H21FN6/c1-3-21-18-22-13(2)10-17(23-18)25-8-6-24(7-9-25)15-5-4-14(12-20)16(19)11-15/h4-5,10-11H,3,6-9H2,1-2H3,(H,21,22,23) |
| InChIKey | IDKZRKDHUYFBSW-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 68.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.41 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |